About ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate
ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate (PubChem CID 172768145) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate.
Molecular Properties
| Compound Name | ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate |
| PubChem CID | 172768145 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate |
| SMILES | CCSC(=O)OOC(=O)C1(C)CCCCC1 |
| InChI | InChI=1S/C11H18O4S/c1-3-16-10(13)15-14-9(12)11(2)7-5-4-6-8-11/h3-8H2,1-2H3 |
| InChIKey | MPAHNUJGNJJFNJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate?
The IUPAC name of ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate (CID 172768145) is ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate.
What is the SMILES notation for ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate?
The canonical SMILES for ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate is CCSC(=O)OOC(=O)C1(C)CCCCC1.
What is the InChIKey of ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate?
The InChIKey is MPAHNUJGNJJFNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c1-3-16-10(13)15-14-9(12)11(2)7-5-4-6-8-11/h3-8H2,1-2H3.
What are the key properties of ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate?
ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate has a molecular weight of 246.33 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanylcarbonyl 1-methylcyclohexane-1-carboperoxoate is sourced from PubChem (CID 172768145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).