C22H18F2OS — CID 172773752
S-(3-phenylphenyl) 4-(2,4-difluorophenyl)butanethioate (PubChem CID 172773752) has the molecular formula C22H18F2OS and a molecular weight of 368.45 g/mol. Its IUPAC name is S-(3-phenylphenyl) 4-(2,4-difluorophenyl)butanethioate.
| Compound Name | S-(3-phenylphenyl) 4-(2,4-difluorophenyl)butanethioate |
|---|---|
| PubChem CID | 172773752 |
| Molecular Formula | C22H18F2OS |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | S-(3-phenylphenyl) 4-(2,4-difluorophenyl)butanethioate |
| SMILES | O=C(CCCc1ccc(F)cc1F)Sc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H18F2OS/c23-19-13-12-17(21(24)15-19)8-5-11-22(25)26-20-10-4-9-18(14-20)16-6-2-1-3-7-16/h1-4,6-7,9-10,12-15H,5,8,11H2 |
| InChIKey | NHQHFBDXOVYCNR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|