C6H9N3O6S — CID 172780795
3-[(2-methoxyiminoacetyl)amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 172780795) has the molecular formula C6H9N3O6S and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-[(2-methoxyiminoacetyl)amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[(2-methoxyiminoacetyl)amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 172780795 |
| Molecular Formula | C6H9N3O6S |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 3-[(2-methoxyiminoacetyl)amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CON=CC(=O)NC1CN(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C6H9N3O6S/c1-15-7-2-5(10)8-4-3-9(6(4)11)16(12,13)14/h2,4H,3H2,1H3,(H,8,10)(H,12,13,14) |
| InChIKey | NYIKRUCINKGGDT-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|