C9H10ClIO4 — CID 172782171
methyl 5-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 172782171) has the molecular formula C9H10ClIO4 and a molecular weight of 344.53 g/mol. Its IUPAC name is methyl 5-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 5-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 172782171 |
| Molecular Formula | C9H10ClIO4 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | methyl 5-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(OC)(OI)C(Cl)=C1 |
| InChI | InChI=1S/C9H10ClIO4/c1-13-8(12)6-3-4-9(14-2,15-11)7(10)5-6/h3,5H,4H2,1-2H3 |
| InChIKey | OKEICDBAKVWZSI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|