C12H17ClN2O5S — CID 172788750
2-amino-5-(butoxymethylsulfamoyl)-4-chlorobenzoic acid (PubChem CID 172788750) has the molecular formula C12H17ClN2O5S and a molecular weight of 336.80 g/mol. Its IUPAC name is 2-amino-5-(butoxymethylsulfamoyl)-4-chlorobenzoic acid.
| Compound Name | 2-amino-5-(butoxymethylsulfamoyl)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 172788750 |
| Molecular Formula | C12H17ClN2O5S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-amino-5-(butoxymethylsulfamoyl)-4-chlorobenzoic acid |
| SMILES | CCCCOCNS(=O)(=O)c1cc(C(=O)O)c(N)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O5S/c1-2-3-4-20-7-15-21(18,19)11-5-8(12(16)17)10(14)6-9(11)13/h5-6,15H,2-4,7,14H2,1H3,(H,16,17) |
| InChIKey | PGOVENNOQXFUHR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|