C15H22O4Si — CID 172794276
4-methyl-2-triethylsilylbenzene-1,3-dicarboxylic acid (PubChem CID 172794276) has the molecular formula C15H22O4Si and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-methyl-2-triethylsilylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-methyl-2-triethylsilylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 172794276 |
| Molecular Formula | C15H22O4Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-methyl-2-triethylsilylbenzene-1,3-dicarboxylic acid |
| SMILES | CC[Si](CC)(CC)c1c(C(=O)O)ccc(C)c1C(=O)O |
| InChI | InChI=1S/C15H22O4Si/c1-5-20(6-2,7-3)13-11(14(16)17)9-8-10(4)12(13)15(18)19/h8-9H,5-7H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | PZGWCNLTWDMGGT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|