C24H21FINO2 — CID 172798108
9H-fluoren-9-ylmethyl N-[(2S)-1-(2-fluoro-5-iodophenyl)propan-2-yl]carbamate (PubChem CID 172798108) has the molecular formula C24H21FINO2 and a molecular weight of 501.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-(2-fluoro-5-iodophenyl)propan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(2-fluoro-5-iodophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 172798108 |
| Molecular Formula | C24H21FINO2 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(2-fluoro-5-iodophenyl)propan-2-yl]carbamate |
| SMILES | C[C@@H](Cc1cc(I)ccc1F)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21FINO2/c1-15(12-16-13-17(26)10-11-23(16)25)27-24(28)29-14-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-11,13,15,22H,12,14H2,1H3,(H,27,28)/t15-/m0/s1 |
| InChIKey | QMFIRSPEOWYPPQ-HNNXBMFYSA-N |
| XLogP | 5.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|