C31H40N2O3S — CID 172805765
hexyl 2-[1-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazol-6-ylidene]pentanoate (PubChem CID 172805765) has the molecular formula C31H40N2O3S and a molecular weight of 520.74 g/mol. Its IUPAC name is hexyl 2-[1-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazol-6-ylidene]pentanoate.
| Compound Name | hexyl 2-[1-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazol-6-ylidene]pentanoate |
|---|---|
| PubChem CID | 172805765 |
| Molecular Formula | C31H40N2O3S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | hexyl 2-[1-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-4,6a-dihydro-3aH-thieno[3,4-d]imidazol-6-ylidene]pentanoate |
| SMILES | CCCCCCOC(=O)C(CCC)=C1SCC2C1N(Cc1ccccc1)C(=O)N2[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C31H40N2O3S/c1-4-6-7-14-20-36-30(34)26(15-5-2)29-28-27(22-37-29)33(23(3)25-18-12-9-13-19-25)31(35)32(28)21-24-16-10-8-11-17-24/h8-13,16-19,23,27-28H,4-7,14-15,20-22H2,1-3H3/t23-,27?,28?/m1/s1 |
| InChIKey | RMHXJMOESAJCNJ-YHHYGRTJSA-N |
| XLogP | 7.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|