C29H34N6O — CID 172807311
1-methyl-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]-C-phenylcarbonimidoyl]pyrrolo[3,2-c]pyridin-2-ol (PubChem CID 172807311) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-methyl-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]-C-phenylcarbonimidoyl]pyrrolo[3,2-c]pyridin-2-ol.
| Compound Name | 1-methyl-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]-C-phenylcarbonimidoyl]pyrrolo[3,2-c]pyridin-2-ol |
|---|---|
| PubChem CID | 172807311 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 1-methyl-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]-C-phenylcarbonimidoyl]pyrrolo[3,2-c]pyridin-2-ol |
| SMILES | CN1CCN(CCN(C)c2ccc(/N=C(\c3ccccc3)c3c(O)n(C)c4ccncc34)cc2)CC1 |
| InChI | InChI=1S/C29H34N6O/c1-32-15-18-35(19-16-32)20-17-33(2)24-11-9-23(10-12-24)31-28(22-7-5-4-6-8-22)27-25-21-30-14-13-26(25)34(3)29(27)36/h4-14,21,36H,15-20H2,1-3H3/b31-28+ |
| InChIKey | HHZPVGNZLZRKDT-CCFHIKDMSA-N |
| XLogP | 4.13 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|