C18H23BrClN5O2 — CID 172818514
butyl 4-[7-bromo-6-chloro-2-(methylamino)quinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 172818514) has the molecular formula C18H23BrClN5O2 and a molecular weight of 456.77 g/mol. Its IUPAC name is butyl 4-[7-bromo-6-chloro-2-(methylamino)quinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[7-bromo-6-chloro-2-(methylamino)quinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172818514 |
| Molecular Formula | C18H23BrClN5O2 |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | butyl 4-[7-bromo-6-chloro-2-(methylamino)quinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2nc(NC)nc3cc(Br)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C18H23BrClN5O2/c1-3-4-9-27-18(26)25-7-5-24(6-8-25)16-12-10-14(20)13(19)11-15(12)22-17(21-2)23-16/h10-11H,3-9H2,1-2H3,(H,21,22,23) |
| InChIKey | TXAKJLDCDLRDTI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|