C8H5ClF4N2NaO2 — CID 172822294
CID 172822294 (PubChem CID 172822294) has the molecular formula C8H5ClF4N2NaO2 and a molecular weight of 295.58 g/mol.
| Compound Name | CID 172822294 |
|---|---|
| PubChem CID | 172822294 |
| Molecular Formula | C8H5ClF4N2NaO2 |
| Molecular Weight | 295.58 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | — |
| SMILES | NC(=O)c1ccc(C(F)(F)C(F)(F)Cl)[nH]c1=O.[Na] |
| InChI | InChI=1S/C8H5ClF4N2O2.Na/c9-8(12,13)7(10,11)4-2-1-3(5(14)16)6(17)15-4;/h1-2H,(H2,14,16)(H,15,17); |
| InChIKey | UJSZKYPAZXCFGR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.58 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|