C12H10N2 — CID 172823650
4H-pyrido[2,1-a]phthalazine (PubChem CID 172823650) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 4H-pyrido[2,1-a]phthalazine.
| Compound Name | 4H-pyrido[2,1-a]phthalazine |
|---|---|
| PubChem CID | 172823650 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 4H-pyrido[2,1-a]phthalazine |
| SMILES | C1=CCN2N=Cc3ccccc3C2=C1 |
| InChI | InChI=1S/C12H10N2/c1-2-6-11-10(5-1)9-13-14-8-4-3-7-12(11)14/h1-7,9H,8H2 |
| InChIKey | UOGZUTDDFBYRPX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |