C27H37N2O4+ — CID 172824365
1-[8-methoxy-1,4-bis(3-methylbutoxy)naphthalen-2-yl]-2-(3-methylimidazol-3-ium-1-yl)ethanone (PubChem CID 172824365) has the molecular formula C27H37N2O4+ and a molecular weight of 453.60 g/mol. Its IUPAC name is 1-[8-methoxy-1,4-bis(3-methylbutoxy)naphthalen-2-yl]-2-(3-methylimidazol-3-ium-1-yl)ethanone.
| Compound Name | 1-[8-methoxy-1,4-bis(3-methylbutoxy)naphthalen-2-yl]-2-(3-methylimidazol-3-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 172824365 |
| Molecular Formula | C27H37N2O4+ |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 1-[8-methoxy-1,4-bis(3-methylbutoxy)naphthalen-2-yl]-2-(3-methylimidazol-3-ium-1-yl)ethanone |
| SMILES | COc1cccc2c(OCCC(C)C)cc(C(=O)Cn3cc[n+](C)c3)c(OCCC(C)C)c12 |
| InChI | InChI=1S/C27H37N2O4/c1-19(2)10-14-32-25-16-22(23(30)17-29-13-12-28(5)18-29)27(33-15-11-20(3)4)26-21(25)8-7-9-24(26)31-6/h7-9,12-13,16,18-20H,10-11,14-15,17H2,1-6H3/q+1 |
| InChIKey | YJVVKJIKNOUPQW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|