C35H41N2O2+ — CID 169273841
1-[[1,4-bis(3-methylbutoxy)naphthalen-2-yl]methyl]-3-(naphthalen-2-ylmethyl)imidazol-3-ium (PubChem CID 169273841) has the molecular formula C35H41N2O2+ and a molecular weight of 521.73 g/mol. Its IUPAC name is 1-[[1,4-bis(3-methylbutoxy)naphthalen-2-yl]methyl]-3-(naphthalen-2-ylmethyl)imidazol-3-ium.
| Compound Name | 1-[[1,4-bis(3-methylbutoxy)naphthalen-2-yl]methyl]-3-(naphthalen-2-ylmethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 169273841 |
| Molecular Formula | C35H41N2O2+ |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | 1-[[1,4-bis(3-methylbutoxy)naphthalen-2-yl]methyl]-3-(naphthalen-2-ylmethyl)imidazol-3-ium |
| SMILES | CC(C)CCOc1cc(Cn2cc[n+](Cc3ccc4ccccc4c3)c2)c(OCCC(C)C)c2ccccc12 |
| InChI | InChI=1S/C35H41N2O2/c1-26(2)15-19-38-34-22-31(35(39-20-16-27(3)4)33-12-8-7-11-32(33)34)24-37-18-17-36(25-37)23-28-13-14-29-9-5-6-10-30(29)21-28/h5-14,17-18,21-22,25-27H,15-16,19-20,23-24H2,1-4H3/q+1 |
| InChIKey | RMPNLENEBNGEGQ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|