C23H19N3 — CID 71561121
3-methyl-2-[3-(naphthalen-2-ylmethyl)imidazol-3-ium-1-yl]indol-1-ide (PubChem CID 71561121) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 3-methyl-2-[3-(naphthalen-2-ylmethyl)imidazol-3-ium-1-yl]indol-1-ide.
| Compound Name | 3-methyl-2-[3-(naphthalen-2-ylmethyl)imidazol-3-ium-1-yl]indol-1-ide |
|---|---|
| PubChem CID | 71561121 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-methyl-2-[3-(naphthalen-2-ylmethyl)imidazol-3-ium-1-yl]indol-1-ide |
| SMILES | Cc1c(-n2cc[n+](Cc3ccc4ccccc4c3)c2)[n-]c2ccccc12 |
| InChI | InChI=1S/C23H19N3/c1-17-21-8-4-5-9-22(21)24-23(17)26-13-12-25(16-26)15-18-10-11-19-6-2-3-7-20(19)14-18/h2-14,16H,15H2,1H3 |
| InChIKey | WRIQVMKKAFWQOH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 22.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|