C11H15NO5S — CID 172825657
3-(2-ethyl-3H-1,2-oxazol-5-yl)benzenesulfonic acid;hydrate (PubChem CID 172825657) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-(2-ethyl-3H-1,2-oxazol-5-yl)benzenesulfonic acid;hydrate.
| Compound Name | 3-(2-ethyl-3H-1,2-oxazol-5-yl)benzenesulfonic acid;hydrate |
|---|---|
| PubChem CID | 172825657 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-(2-ethyl-3H-1,2-oxazol-5-yl)benzenesulfonic acid;hydrate |
| SMILES | CCN1CC=C(c2cccc(S(=O)(=O)O)c2)O1.O |
| InChI | InChI=1S/C11H13NO4S.H2O/c1-2-12-7-6-11(16-12)9-4-3-5-10(8-9)17(13,14)15;/h3-6,8H,2,7H2,1H3,(H,13,14,15);1H2 |
| InChIKey | UVBFQSNMWDRZLX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|