C29H38N6O3 — CID 172828124
2-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid (PubChem CID 172828124) has the molecular formula C29H38N6O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid.
| Compound Name | 2-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 172828124 |
| Molecular Formula | C29H38N6O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 2-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
| SMILES | CCC(Nc1ccccn1)(C(=O)O)N(CCCCc1ccc2c(n1)NCCC2)CCOc1cccnc1C |
| InChI | InChI=1S/C29H38N6O3/c1-3-29(28(36)37,34-26-13-4-6-16-31-26)35(20-21-38-25-12-9-17-30-22(25)2)19-7-5-11-24-15-14-23-10-8-18-32-27(23)33-24/h4,6,9,12-17H,3,5,7-8,10-11,18-21H2,1-2H3,(H,31,34)(H,32,33)(H,36,37) |
| InChIKey | VDOLRYNLTMVOKO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|