C12H22N2O3 — CID 172832947
4-[methyl-(2-methylprop-2-enoylamino)-propylazaniumyl]butanoate (PubChem CID 172832947) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[methyl-(2-methylprop-2-enoylamino)-propylazaniumyl]butanoate.
| Compound Name | 4-[methyl-(2-methylprop-2-enoylamino)-propylazaniumyl]butanoate |
|---|---|
| PubChem CID | 172832947 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4-[methyl-(2-methylprop-2-enoylamino)-propylazaniumyl]butanoate |
| SMILES | C=C(C)C(=O)N[N+](C)(CCC)CCCC(=O)[O-] |
| InChI | InChI=1S/C12H22N2O3/c1-5-8-14(4,9-6-7-11(15)16)13-12(17)10(2)3/h2,5-9H2,1,3-4H3,(H-,13,15,16,17) |
| InChIKey | VTJLYVJEJVRHDY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|