C12H25N2O4S+ — CID 87721561
3-methoxysulfonylpropyl-methyl-(2-methylprop-2-enoylamino)-propylazanium (PubChem CID 87721561) has the molecular formula C12H25N2O4S+ and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-methoxysulfonylpropyl-methyl-(2-methylprop-2-enoylamino)-propylazanium.
| Compound Name | 3-methoxysulfonylpropyl-methyl-(2-methylprop-2-enoylamino)-propylazanium |
|---|---|
| PubChem CID | 87721561 |
| Molecular Formula | C12H25N2O4S+ |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-methoxysulfonylpropyl-methyl-(2-methylprop-2-enoylamino)-propylazanium |
| SMILES | C=C(C)C(=O)N[N+](C)(CCC)CCCS(=O)(=O)OC |
| InChI | InChI=1S/C12H24N2O4S/c1-6-8-14(4,13-12(15)11(2)3)9-7-10-19(16,17)18-5/h2,6-10H2,1,3-5H3/p+1 |
| InChIKey | AGVGOFPDMAEZPC-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|