C7H13NO5S — CID 87793895
(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate (PubChem CID 87793895) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate.
| Compound Name | (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 87793895 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate |
| SMILES | C=C(C)C(=O)NOS(=O)(=O)CCCO |
| InChI | InChI=1S/C7H13NO5S/c1-6(2)7(10)8-13-14(11,12)5-3-4-9/h9H,1,3-5H2,2H3,(H,8,10) |
| InChIKey | MVIKWTKKNWYONO-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|