(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate

C7H13NO5S — CID 87793895

IUPAC(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate
SMILESC=C(C)C(=O)NOS(=O)(=O)CCCO
InChIInChI=1S/C7H13NO5S/c1-6(2)7(10)8-13-14(11,12)5-3-4-9/h9H,1,3-5H2,2H3,(H,8,10)
InChIKeyMVIKWTKKNWYONO-UHFFFAOYSA-N
MW223.25 g/mol
LogP-0.68
Rot. Bonds6

About (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate

(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate (PubChem CID 87793895) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate.

Molecular Properties

Compound Name(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate
PubChem CID87793895
Molecular FormulaC7H13NO5S
Molecular Weight223.25 g/mol
Exact Mass223.05
IUPAC Name(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate
SMILESC=C(C)C(=O)NOS(=O)(=O)CCCO
InChIInChI=1S/C7H13NO5S/c1-6(2)7(10)8-13-14(11,12)5-3-4-9/h9H,1,3-5H2,2H3,(H,8,10)
InChIKeyMVIKWTKKNWYONO-UHFFFAOYSA-N
XLogP-0.68
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.25
LogP ≤ 5-0.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate?
The IUPAC name of (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate (CID 87793895) is (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate.
What is the SMILES notation for (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate?
The canonical SMILES for (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate is C=C(C)C(=O)NOS(=O)(=O)CCCO.
What is the InChIKey of (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate?
The InChIKey is MVIKWTKKNWYONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO5S/c1-6(2)7(10)8-13-14(11,12)5-3-4-9/h9H,1,3-5H2,2H3,(H,8,10).
What are the key properties of (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate?
(2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate has a molecular weight of 223.25 g/mol, XLogP of -0.68, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylprop-2-enoylamino) 3-hydroxypropane-1-sulfonate is sourced from PubChem (CID 87793895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).