C9H12N2O5 — CID 174523368
bis(2-methylprop-2-enoylamino) carbonate (PubChem CID 174523368) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is bis(2-methylprop-2-enoylamino) carbonate.
| Compound Name | bis(2-methylprop-2-enoylamino) carbonate |
|---|---|
| PubChem CID | 174523368 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | bis(2-methylprop-2-enoylamino) carbonate |
| SMILES | C=C(C)C(=O)NOC(=O)ONC(=O)C(=C)C |
| InChI | InChI=1S/C9H12N2O5/c1-5(2)7(12)10-15-9(14)16-11-8(13)6(3)4/h1,3H2,2,4H3,(H,10,12)(H,11,13) |
| InChIKey | XVGNSRNRFFRSFP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|