C8H12N2O6S — CID 174631095
bis(2-methylprop-2-enoylamino) sulfate (PubChem CID 174631095) has the molecular formula C8H12N2O6S and a molecular weight of 264.26 g/mol. Its IUPAC name is bis(2-methylprop-2-enoylamino) sulfate.
| Compound Name | bis(2-methylprop-2-enoylamino) sulfate |
|---|---|
| PubChem CID | 174631095 |
| Molecular Formula | C8H12N2O6S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | bis(2-methylprop-2-enoylamino) sulfate |
| SMILES | C=C(C)C(=O)NOS(=O)(=O)ONC(=O)C(=C)C |
| InChI | InChI=1S/C8H12N2O6S/c1-5(2)7(11)9-15-17(13,14)16-10-8(12)6(3)4/h1,3H2,2,4H3,(H,9,11)(H,10,12) |
| InChIKey | TWXQPWLAFSFUEN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|