C12H24N2O4S — CID 87201956
3-(2-methylprop-2-enoylamino)propyl 3-amino-3-methylbutane-1-sulfonate (PubChem CID 87201956) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoylamino)propyl 3-amino-3-methylbutane-1-sulfonate.
| Compound Name | 3-(2-methylprop-2-enoylamino)propyl 3-amino-3-methylbutane-1-sulfonate |
|---|---|
| PubChem CID | 87201956 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-(2-methylprop-2-enoylamino)propyl 3-amino-3-methylbutane-1-sulfonate |
| SMILES | C=C(C)C(=O)NCCCOS(=O)(=O)CCC(C)(C)N |
| InChI | InChI=1S/C12H24N2O4S/c1-10(2)11(15)14-7-5-8-18-19(16,17)9-6-12(3,4)13/h1,5-9,13H2,2-4H3,(H,14,15) |
| InChIKey | ZOHVMAHUGAZLHG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|