C15H20F3NO3Si — CID 172835209
tert-butyl 3,3-dimethyl-5-(trifluoromethoxy)-2H-1,3-benzazasilole-1-carboxylate (PubChem CID 172835209) has the molecular formula C15H20F3NO3Si and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-5-(trifluoromethoxy)-2H-1,3-benzazasilole-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethyl-5-(trifluoromethoxy)-2H-1,3-benzazasilole-1-carboxylate |
|---|---|
| PubChem CID | 172835209 |
| Molecular Formula | C15H20F3NO3Si |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl 3,3-dimethyl-5-(trifluoromethoxy)-2H-1,3-benzazasilole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[Si](C)(C)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H20F3NO3Si/c1-14(2,3)22-13(20)19-9-23(4,5)12-8-10(6-7-11(12)19)21-15(16,17)18/h6-8H,9H2,1-5H3 |
| InChIKey | WBCDGNFOMCYAOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|