C44H44N4O4S — CID 172835723
[1-[6-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbenzoyl]-9-(4-octanoylphenyl)carbazol-3-yl]ethylideneamino] acetate (PubChem CID 172835723) has the molecular formula C44H44N4O4S and a molecular weight of 724.93 g/mol. Its IUPAC name is [1-[6-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbenzoyl]-9-(4-octanoylphenyl)carbazol-3-yl]ethylideneamino] acetate.
| Compound Name | [1-[6-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbenzoyl]-9-(4-octanoylphenyl)carbazol-3-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 172835723 |
| Molecular Formula | C44H44N4O4S |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | [1-[6-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylbenzoyl]-9-(4-octanoylphenyl)carbazol-3-yl]ethylideneamino] acetate |
| SMILES | CCCCCCCC(=O)c1ccc(-n2c3ccc(C(=O)c4ccc(Sc5nc(C)cc(C)n5)cc4C)cc3c3cc(C(C)=NOC(C)=O)ccc32)cc1 |
| InChI | InChI=1S/C44H44N4O4S/c1-7-8-9-10-11-12-42(50)32-13-17-35(18-14-32)48-40-21-15-33(30(5)47-52-31(6)49)25-38(40)39-26-34(16-22-41(39)48)43(51)37-20-19-36(23-27(37)2)53-44-45-28(3)24-29(4)46-44/h13-26H,7-12H2,1-6H3 |
| InChIKey | WCYXERNVHUIABI-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 103.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|