C57H94O7Si — CID 172836159
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-diethyl-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid (PubChem CID 172836159) has the molecular formula C57H94O7Si and a molecular weight of 919.46 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-diethyl-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-diethyl-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid |
|---|---|
| PubChem CID | 172836159 |
| Molecular Formula | C57H94O7Si |
| Molecular Weight | 919.46 g/mol |
| Exact Mass | 918.68 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-diethyl-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)(CC(CO[Si](C)(C)C(C)(C)C)C(CC)(OCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C57H94O7Si/c1-10-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-44-46-48-62-56(12-3,53(58)59)50-52(51-64-65(8,9)55(5,6)7)57(13-4,54(60)61)63-49-47-45-43-41-39-37-35-33-31-29-27-25-23-21-19-17-15-11-2/h14-17,20-23,26-29,32-35,38-41,52H,10-13,18-19,24-25,30-31,36-37,42-51H2,1-9H3,(H,58,59)(H,60,61)/b16-14-,17-15-,22-20-,23-21-,28-26-,29-27-,34-32-,35-33-,40-38-,41-39- |
| InChIKey | WEHBMLSODFPKKU-HEGDWURESA-N |
| XLogP | 16.36 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.46 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|