C10H10N2O4S — CID 172839879
1,4-benzodiazepin-5-one;methanesulfonic acid (PubChem CID 172839879) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 1,4-benzodiazepin-5-one;methanesulfonic acid.
| Compound Name | 1,4-benzodiazepin-5-one;methanesulfonic acid |
|---|---|
| PubChem CID | 172839879 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1,4-benzodiazepin-5-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=c1nccnc2ccccc12 |
| InChI | InChI=1S/C9H6N2O.CH4O3S/c12-9-7-3-1-2-4-8(7)10-5-6-11-9;1-5(2,3)4/h1-6H;1H3,(H,2,3,4) |
| InChIKey | WQOSKRBBYPURJL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|