About cinnolin-4-amine;methanesulfonic acid
cinnolin-4-amine;methanesulfonic acid (PubChem CID 174552830) has the molecular formula C9H11N3O3S
and a molecular weight of 241.27 g/mol. Its IUPAC name is cinnolin-4-amine;methanesulfonic acid.
Molecular Properties
| Compound Name | cinnolin-4-amine;methanesulfonic acid |
| PubChem CID | 174552830 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | cinnolin-4-amine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1cnnc2ccccc12 |
| InChI | InChI=1S/C8H7N3.CH4O3S/c9-7-5-10-11-8-4-2-1-3-6(7)8;1-5(2,3)4/h1-5H,(H2,9,11);1H3,(H,2,3,4) |
| InChIKey | BNBYINWEAKJMQV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cinnolin-4-amine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnolin-4-amine;methanesulfonic acid?
The IUPAC name of cinnolin-4-amine;methanesulfonic acid (CID 174552830) is cinnolin-4-amine;methanesulfonic acid.
What is the SMILES notation for cinnolin-4-amine;methanesulfonic acid?
The canonical SMILES for cinnolin-4-amine;methanesulfonic acid is CS(=O)(=O)O.Nc1cnnc2ccccc12.
What is the InChIKey of cinnolin-4-amine;methanesulfonic acid?
The InChIKey is BNBYINWEAKJMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.CH4O3S/c9-7-5-10-11-8-4-2-1-3-6(7)8;1-5(2,3)4/h1-5H,(H2,9,11);1H3,(H,2,3,4).
What are the key properties of cinnolin-4-amine;methanesulfonic acid?
cinnolin-4-amine;methanesulfonic acid has a molecular weight of 241.27 g/mol, XLogP of 0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-4-amine;methanesulfonic acid is sourced from PubChem (CID 174552830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).