cinnolin-4-amine;methanesulfonic acid

C9H11N3O3S — CID 174552830

IUPACcinnolin-4-amine;methanesulfonic acid
SMILESCS(=O)(=O)O.Nc1cnnc2ccccc12
InChIInChI=1S/C8H7N3.CH4O3S/c9-7-5-10-11-8-4-2-1-3-6(7)8;1-5(2,3)4/h1-5H,(H2,9,11);1H3,(H,2,3,4)
InChIKeyBNBYINWEAKJMQV-UHFFFAOYSA-N
MW241.27 g/mol
LogP0.72
Rot. Bonds

About cinnolin-4-amine;methanesulfonic acid

cinnolin-4-amine;methanesulfonic acid (PubChem CID 174552830) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is cinnolin-4-amine;methanesulfonic acid.

Molecular Properties

Compound Namecinnolin-4-amine;methanesulfonic acid
PubChem CID174552830
Molecular FormulaC9H11N3O3S
Molecular Weight241.27 g/mol
Exact Mass241.05
IUPAC Namecinnolin-4-amine;methanesulfonic acid
SMILESCS(=O)(=O)O.Nc1cnnc2ccccc12
InChIInChI=1S/C8H7N3.CH4O3S/c9-7-5-10-11-8-4-2-1-3-6(7)8;1-5(2,3)4/h1-5H,(H2,9,11);1H3,(H,2,3,4)
InChIKeyBNBYINWEAKJMQV-UHFFFAOYSA-N
XLogP0.72
TPSA106.17 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.27
LogP ≤ 50.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze cinnolin-4-amine;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cinnolin-4-amine;methanesulfonic acid?
The IUPAC name of cinnolin-4-amine;methanesulfonic acid (CID 174552830) is cinnolin-4-amine;methanesulfonic acid.
What is the SMILES notation for cinnolin-4-amine;methanesulfonic acid?
The canonical SMILES for cinnolin-4-amine;methanesulfonic acid is CS(=O)(=O)O.Nc1cnnc2ccccc12.
What is the InChIKey of cinnolin-4-amine;methanesulfonic acid?
The InChIKey is BNBYINWEAKJMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.CH4O3S/c9-7-5-10-11-8-4-2-1-3-6(7)8;1-5(2,3)4/h1-5H,(H2,9,11);1H3,(H,2,3,4).
What are the key properties of cinnolin-4-amine;methanesulfonic acid?
cinnolin-4-amine;methanesulfonic acid has a molecular weight of 241.27 g/mol, XLogP of 0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-4-amine;methanesulfonic acid is sourced from PubChem (CID 174552830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).