C8H12FNO4 — CID 172841244
methyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 172841244) has the molecular formula C8H12FNO4 and a molecular weight of 205.18 g/mol. Its IUPAC name is methyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | methyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 172841244 |
| Molecular Formula | C8H12FNO4 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | methyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | COC(=O)N1CC(F)C2OCC(O)C21 |
| InChI | InChI=1S/C8H12FNO4/c1-13-8(12)10-2-4(9)7-6(10)5(11)3-14-7/h4-7,11H,2-3H2,1H3 |
| InChIKey | WVBCXULAEZYLFE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |