C7H10F3NO2 — CID 172855381
(E)-5,5,5-trifluoro-3-methyl-2-(methylamino)pent-2-enoic acid (PubChem CID 172855381) has the molecular formula C7H10F3NO2 and a molecular weight of 197.16 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-3-methyl-2-(methylamino)pent-2-enoic acid.
| Compound Name | (E)-5,5,5-trifluoro-3-methyl-2-(methylamino)pent-2-enoic acid |
|---|---|
| PubChem CID | 172855381 |
| Molecular Formula | C7H10F3NO2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (E)-5,5,5-trifluoro-3-methyl-2-(methylamino)pent-2-enoic acid |
| SMILES | CN/C(C(=O)O)=C(\C)CC(F)(F)F |
| InChI | InChI=1S/C7H10F3NO2/c1-4(3-7(8,9)10)5(11-2)6(12)13/h11H,3H2,1-2H3,(H,12,13)/b5-4+ |
| InChIKey | YQAYTXYJEWXQKH-SNAWJCMRSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|