C21H27ClN2O5S — CID 172856866
4-[4-[(3-chlorophenyl)sulfonylamino]butanoylamino]adamantane-1-carboxylic acid (PubChem CID 172856866) has the molecular formula C21H27ClN2O5S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-[4-[(3-chlorophenyl)sulfonylamino]butanoylamino]adamantane-1-carboxylic acid.
| Compound Name | 4-[4-[(3-chlorophenyl)sulfonylamino]butanoylamino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 172856866 |
| Molecular Formula | C21H27ClN2O5S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-[4-[(3-chlorophenyl)sulfonylamino]butanoylamino]adamantane-1-carboxylic acid |
| SMILES | O=C(CCCNS(=O)(=O)c1cccc(Cl)c1)NC1C2CC3CC1CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C21H27ClN2O5S/c22-16-3-1-4-17(9-16)30(28,29)23-6-2-5-18(25)24-19-14-7-13-8-15(19)12-21(10-13,11-14)20(26)27/h1,3-4,9,13-15,19,23H,2,5-8,10-12H2,(H,24,25)(H,26,27) |
| InChIKey | YVADRCBQRGMQNL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|