About calcium;azane;urea
calcium;azane;urea (PubChem CID 172861294) has the molecular formula CH7CaN3O+2
and a molecular weight of 117.17 g/mol. Its IUPAC name is calcium;azane;urea.
Molecular Properties
| Compound Name | calcium;azane;urea |
| PubChem CID | 172861294 |
| Molecular Formula | CH7CaN3O+2 |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | calcium;azane;urea |
| SMILES | N.NC(N)=O.[Ca+2] |
| InChI | InChI=1S/CH4N2O.Ca.H3N/c2-1(3)4;;/h(H4,2,3,4);;1H3/q;+2; |
| InChIKey | ZJSOPLUIBQVONA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;azane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;azane;urea?
The IUPAC name of calcium;azane;urea (CID 172861294) is calcium;azane;urea.
What is the SMILES notation for calcium;azane;urea?
The canonical SMILES for calcium;azane;urea is N.NC(N)=O.[Ca+2].
What is the InChIKey of calcium;azane;urea?
The InChIKey is ZJSOPLUIBQVONA-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.Ca.H3N/c2-1(3)4;;/h(H4,2,3,4);;1H3/q;+2;.
What are the key properties of calcium;azane;urea?
calcium;azane;urea has a molecular weight of 117.17 g/mol, XLogP of -1.20, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;azane;urea is sourced from PubChem (CID 172861294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).