About azane;ethylsulfanylphosphonous acid
azane;ethylsulfanylphosphonous acid (PubChem CID 172865056) has the molecular formula C2H13N2O2PS
and a molecular weight of 160.18 g/mol. Its IUPAC name is azane;ethylsulfanylphosphonous acid.
Molecular Properties
| Compound Name | azane;ethylsulfanylphosphonous acid |
| PubChem CID | 172865056 |
| Molecular Formula | C2H13N2O2PS |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | azane;ethylsulfanylphosphonous acid |
| SMILES | CCSP(O)O.N.N |
| InChI | InChI=1S/C2H7O2PS.2H3N/c1-2-6-5(3)4;;/h3-4H,2H2,1H3;2*1H3 |
| InChIKey | ZWJUENLCKCRQEB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;ethylsulfanylphosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethylsulfanylphosphonous acid?
The IUPAC name of azane;ethylsulfanylphosphonous acid (CID 172865056) is azane;ethylsulfanylphosphonous acid.
What is the SMILES notation for azane;ethylsulfanylphosphonous acid?
The canonical SMILES for azane;ethylsulfanylphosphonous acid is CCSP(O)O.N.N.
What is the InChIKey of azane;ethylsulfanylphosphonous acid?
The InChIKey is ZWJUENLCKCRQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7O2PS.2H3N/c1-2-6-5(3)4;;/h3-4H,2H2,1H3;2*1H3.
What are the key properties of azane;ethylsulfanylphosphonous acid?
azane;ethylsulfanylphosphonous acid has a molecular weight of 160.18 g/mol, XLogP of 1.27, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethylsulfanylphosphonous acid is sourced from PubChem (CID 172865056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).