About N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid
N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid (PubChem CID 87602181) has the molecular formula C6H19NO4P2
and a molecular weight of 231.17 g/mol. Its IUPAC name is N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid |
| PubChem CID | 87602181 |
| Molecular Formula | C6H19NO4P2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid |
| SMILES | CCN(CC)CC.OP(O)P(O)O |
| InChI | InChI=1S/C6H15N.H4O4P2/c1-4-7(5-2)6-3;1-5(2)6(3)4/h4-6H2,1-3H3;1-4H |
| InChIKey | TUUTVIJGZDVYKQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid?
The IUPAC name of N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid (CID 87602181) is N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid.
What is the SMILES notation for N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid?
The canonical SMILES for N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid is CCN(CC)CC.OP(O)P(O)O.
What is the InChIKey of N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid?
The InChIKey is TUUTVIJGZDVYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.H4O4P2/c1-4-7(5-2)6-3;1-5(2)6(3)4/h4-6H2,1-3H3;1-4H.
What are the key properties of N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid?
N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid has a molecular weight of 231.17 g/mol, XLogP of 0.84, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;dihydroxyphosphanylphosphonous acid is sourced from PubChem (CID 87602181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).