C23H24FN5O3 — CID 172895635
1-(3H-benzimidazol-5-yl)-N-[[5-(3-fluoro-4-propoxyphenyl)pyrimidin-2-yl]methyl]methanamine;formic acid (PubChem CID 172895635) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-N-[[5-(3-fluoro-4-propoxyphenyl)pyrimidin-2-yl]methyl]methanamine;formic acid.
| Compound Name | 1-(3H-benzimidazol-5-yl)-N-[[5-(3-fluoro-4-propoxyphenyl)pyrimidin-2-yl]methyl]methanamine;formic acid |
|---|---|
| PubChem CID | 172895635 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-N-[[5-(3-fluoro-4-propoxyphenyl)pyrimidin-2-yl]methyl]methanamine;formic acid |
| SMILES | CCCOc1ccc(-c2cnc(CNCc3ccc4nc[nH]c4c3)nc2)cc1F.O=CO |
| InChI | InChI=1S/C22H22FN5O.CH2O2/c1-2-7-29-21-6-4-16(9-18(21)23)17-11-25-22(26-12-17)13-24-10-15-3-5-19-20(8-15)28-14-27-19;2-1-3/h3-6,8-9,11-12,14,24H,2,7,10,13H2,1H3,(H,27,28);1H,(H,2,3) |
| InChIKey | GDVSMMFNCRGHSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|