About 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine
4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine (PubChem CID 172901215) has the molecular formula C17H23N3OS2
and a molecular weight of 349.53 g/mol. Its IUPAC name is 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine |
| PubChem CID | 172901215 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine |
| SMILES | CSc1cccc2sc(N3CCCC(N4CCOCC4)C3)nc12 |
| InChI | InChI=1S/C17H23N3OS2/c1-22-14-5-2-6-15-16(14)18-17(23-15)20-7-3-4-13(12-20)19-8-10-21-11-9-19/h2,5-6,13H,3-4,7-12H2,1H3 |
| InChIKey | IGLMQDNGKZDXFT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine?
The IUPAC name of 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine (CID 172901215) is 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine.
What is the SMILES notation for 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine?
The canonical SMILES for 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine is CSc1cccc2sc(N3CCCC(N4CCOCC4)C3)nc12.
What is the InChIKey of 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine?
The InChIKey is IGLMQDNGKZDXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3OS2/c1-22-14-5-2-6-15-16(14)18-17(23-15)20-7-3-4-13(12-20)19-8-10-21-11-9-19/h2,5-6,13H,3-4,7-12H2,1H3.
What are the key properties of 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine?
4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine has a molecular weight of 349.53 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-methylsulfanyl-1,3-benzothiazol-2-yl)piperidin-3-yl]morpholine is sourced from PubChem (CID 172901215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).