C12H18N4O4S — CID 172908581
(3S)-1-[(2-methoxy-3-pyridinyl)sulfamoyl]piperidine-3-carboxamide (PubChem CID 172908581) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is (3S)-1-[(2-methoxy-3-pyridinyl)sulfamoyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2-methoxy-3-pyridinyl)sulfamoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 172908581 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (3S)-1-[(2-methoxy-3-pyridinyl)sulfamoyl]piperidine-3-carboxamide |
| SMILES | COc1ncccc1NS(=O)(=O)N1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C12H18N4O4S/c1-20-12-10(5-2-6-14-12)15-21(18,19)16-7-3-4-9(8-16)11(13)17/h2,5-6,9,15H,3-4,7-8H2,1H3,(H2,13,17)/t9-/m0/s1 |
| InChIKey | BWOXLKDHBJDGAX-VIFPVBQESA-N |
| XLogP | -0.06 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |