C14H9BrO4 — CID 172909409
4-(6-bromo-1,3-benzodioxol-5-yl)benzoic acid (PubChem CID 172909409) has the molecular formula C14H9BrO4 and a molecular weight of 321.13 g/mol. Its IUPAC name is 4-(6-bromo-1,3-benzodioxol-5-yl)benzoic acid.
| Compound Name | 4-(6-bromo-1,3-benzodioxol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 172909409 |
| Molecular Formula | C14H9BrO4 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 4-(6-bromo-1,3-benzodioxol-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C14H9BrO4/c15-11-6-13-12(18-7-19-13)5-10(11)8-1-3-9(4-2-8)14(16)17/h1-6H,7H2,(H,16,17) |
| InChIKey | IDKJJMLYHDKZCR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |