C22H36N2O2 — CID 172916676
(Z)-[(8'R,9'S,10'S,13'S,14'S)-2',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ylidene]hydrazine (PubChem CID 172916676) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (Z)-[(8'R,9'S,10'S,13'S,14'S)-2',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ylidene]hydrazine.
| Compound Name | (Z)-[(8'R,9'S,10'S,13'S,14'S)-2',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ylidene]hydrazine |
|---|---|
| PubChem CID | 172916676 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (Z)-[(8'R,9'S,10'S,13'S,14'S)-2',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ylidene]hydrazine |
| SMILES | CC1C[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)/C(=N\N)CC[C@@H]32)CC12OCCO2 |
| InChI | InChI=1S/C22H36N2O2/c1-14-12-21(3)15(13-22(14)25-10-11-26-22)4-5-16-17-6-7-19(24-23)20(17,2)9-8-18(16)21/h14-18H,4-13,23H2,1-3H3/b24-19-/t14?,15?,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | LKDMVWOGWWWVJY-ANPYCDAZSA-N |
| XLogP | 4.33 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|