C15H20N2O7S — CID 172917238
2-[(Z)-[carboxy-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-thiazol-4-yl]methylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 172917238) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-[(Z)-[carboxy-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-thiazol-4-yl]methylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[carboxy-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-thiazol-4-yl]methylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 172917238 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[(Z)-[carboxy-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-thiazol-4-yl]methylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)Cc1nc(/C(=N/OC(C)(C)C(=O)O)C(=O)O)cs1 |
| InChI | InChI=1S/C15H20N2O7S/c1-14(2,3)23-10(18)6-9-16-8(7-25-9)11(12(19)20)17-24-15(4,5)13(21)22/h7H,6H2,1-5H3,(H,19,20)(H,21,22)/b17-11- |
| InChIKey | HUZOHFMAQGVYLQ-BOPFTXTBSA-N |
| XLogP | 1.70 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|