C9H11N3O6 — CID 88740524
2-[(Z)-[(2-amino-1,3-oxazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 88740524) has the molecular formula C9H11N3O6 and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-[(Z)-[(2-amino-1,3-oxazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[(2-amino-1,3-oxazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88740524 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[(Z)-[(2-amino-1,3-oxazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(\C(=O)O)c1coc(N)n1)C(=O)O |
| InChI | InChI=1S/C9H11N3O6/c1-9(2,7(15)16)18-12-5(6(13)14)4-3-17-8(10)11-4/h3H,1-2H3,(H2,10,11)(H,13,14)(H,15,16)/b12-5- |
| InChIKey | DAZTZGLHZJNODE-XGICHPGQSA-N |
| XLogP | -0.07 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|