C38H50N4O11 — CID 172923163
(3E)-3-(6-aminooxyhexoxyimino)butan-2-one;benzene-1,3,5-tricarbaldehyde;5-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]benzene-1,3-dicarbaldehyde (PubChem CID 172923163) has the molecular formula C38H50N4O11 and a molecular weight of 738.84 g/mol. Its IUPAC name is (3E)-3-(6-aminooxyhexoxyimino)butan-2-one;benzene-1,3,5-tricarbaldehyde;5-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]benzene-1,3-dicarbaldehyde.
| Compound Name | (3E)-3-(6-aminooxyhexoxyimino)butan-2-one;benzene-1,3,5-tricarbaldehyde;5-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 172923163 |
| Molecular Formula | C38H50N4O11 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 738.35 |
| IUPAC Name | (3E)-3-(6-aminooxyhexoxyimino)butan-2-one;benzene-1,3,5-tricarbaldehyde;5-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]benzene-1,3-dicarbaldehyde |
| SMILES | CC(=O)/C(C)=N/OCCCCCCO/N=C/c1cc(C=O)cc(C=O)c1.CC(=O)/C(C)=N/OCCCCCCON.O=Cc1cc(C=O)cc(C=O)c1 |
| InChI | InChI=1S/C19H24N2O5.C10H20N2O3.C9H6O3/c1-15(16(2)24)21-26-8-6-4-3-5-7-25-20-12-17-9-18(13-22)11-19(10-17)14-23;1-9(10(2)13)12-15-8-6-4-3-5-7-14-11;10-4-7-1-8(5-11)3-9(2-7)6-12/h9-14H,3-8H2,1-2H3;3-8,11H2,1-2H3;1-6H/b20-12+,21-15+;12-9+; |
| InChIKey | VRBGXVFNJPPXBW-FLPLRFEGSA-N |
| XLogP | 5.75 |
| TPSA | 219.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|