C25H20ClN3O6S2 — CID 172923703
2-[1-[(Z)-[[2-[(5-chlorothiophen-2-yl)sulfonylamino]-5-methylbenzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid (PubChem CID 172923703) has the molecular formula C25H20ClN3O6S2 and a molecular weight of 558.04 g/mol. Its IUPAC name is 2-[1-[(Z)-[[2-[(5-chlorothiophen-2-yl)sulfonylamino]-5-methylbenzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid.
| Compound Name | 2-[1-[(Z)-[[2-[(5-chlorothiophen-2-yl)sulfonylamino]-5-methylbenzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 172923703 |
| Molecular Formula | C25H20ClN3O6S2 |
| Molecular Weight | 558.04 g/mol |
| Exact Mass | 557.05 |
| IUPAC Name | 2-[1-[(Z)-[[2-[(5-chlorothiophen-2-yl)sulfonylamino]-5-methylbenzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Cl)s2)c(C(=O)N/N=C\c2c(OCC(=O)O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C25H20ClN3O6S2/c1-15-6-8-20(29-37(33,34)24-11-10-22(26)36-24)18(12-15)25(32)28-27-13-19-17-5-3-2-4-16(17)7-9-21(19)35-14-23(30)31/h2-13,29H,14H2,1H3,(H,28,32)(H,30,31)/b27-13- |
| InChIKey | SYSCZAQVGQSUIV-WKIKZPBSSA-N |
| XLogP | 4.89 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.04 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|