C21H17BrClN3O7S2 — CID 171133835
2-[2-[[[5-bromo-2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-5-methoxyphenoxy]acetic acid (PubChem CID 171133835) has the molecular formula C21H17BrClN3O7S2 and a molecular weight of 602.87 g/mol. Its IUPAC name is 2-[2-[[[5-bromo-2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-5-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[[[5-bromo-2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-5-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 171133835 |
| Molecular Formula | C21H17BrClN3O7S2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 600.94 |
| IUPAC Name | 2-[2-[[[5-bromo-2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-5-methoxyphenoxy]acetic acid |
| SMILES | COc1ccc(C=NNC(=O)c2cc(Br)ccc2NS(=O)(=O)c2ccc(Cl)s2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C21H17BrClN3O7S2/c1-32-14-4-2-12(17(9-14)33-11-19(27)28)10-24-25-21(29)15-8-13(22)3-5-16(15)26-35(30,31)20-7-6-18(23)34-20/h2-10,26H,11H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | NFAQZQKOXMSTAG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|