C21H18FN3O6S2 — CID 172923713
2-[2-[(Z)-[[5-fluoro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-4-methylphenoxy]acetic acid (PubChem CID 172923713) has the molecular formula C21H18FN3O6S2 and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-[2-[(Z)-[[5-fluoro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-4-methylphenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[[5-fluoro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-4-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 172923713 |
| Molecular Formula | C21H18FN3O6S2 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[2-[(Z)-[[5-fluoro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-4-methylphenoxy]acetic acid |
| SMILES | Cc1ccc(OCC(=O)O)c(/C=N\NC(=O)c2cc(F)ccc2NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H18FN3O6S2/c1-13-4-7-18(31-12-19(26)27)14(9-13)11-23-24-21(28)16-10-15(22)5-6-17(16)25-33(29,30)20-3-2-8-32-20/h2-11,25H,12H2,1H3,(H,24,28)(H,26,27)/b23-11- |
| InChIKey | ZZZSWXRKIMBHCO-KSEXSDGBSA-N |
| XLogP | 3.22 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|