C21H17ClFN3O6S2 — CID 171133768
2-[2-[[[5-chloro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-6-fluorophenoxy]propanoic acid (PubChem CID 171133768) has the molecular formula C21H17ClFN3O6S2 and a molecular weight of 525.97 g/mol. Its IUPAC name is 2-[2-[[[5-chloro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-6-fluorophenoxy]propanoic acid.
| Compound Name | 2-[2-[[[5-chloro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-6-fluorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 171133768 |
| Molecular Formula | C21H17ClFN3O6S2 |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 2-[2-[[[5-chloro-2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]-6-fluorophenoxy]propanoic acid |
| SMILES | CC(Oc1c(F)cccc1C=NNC(=O)c1cc(Cl)ccc1NS(=O)(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C21H17ClFN3O6S2/c1-12(21(28)29)32-19-13(4-2-5-16(19)23)11-24-25-20(27)15-10-14(22)7-8-17(15)26-34(30,31)18-6-3-9-33-18/h2-12,26H,1H3,(H,25,27)(H,28,29) |
| InChIKey | MCVZJUDDIXIXQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|