C24H18ClN3O6S2 — CID 171133764
2-[1-[[[2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid (PubChem CID 171133764) has the molecular formula C24H18ClN3O6S2 and a molecular weight of 544.01 g/mol. Its IUPAC name is 2-[1-[[[2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid.
| Compound Name | 2-[1-[[[2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 171133764 |
| Molecular Formula | C24H18ClN3O6S2 |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | 2-[1-[[[2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl]oxyacetic acid |
| SMILES | O=C(O)COc1ccc2ccccc2c1C=NNC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C24H18ClN3O6S2/c25-21-11-12-23(35-21)36(32,33)28-19-8-4-3-7-17(19)24(31)27-26-13-18-16-6-2-1-5-15(16)9-10-20(18)34-14-22(29)30/h1-13,28H,14H2,(H,27,31)(H,29,30) |
| InChIKey | BVYAZVSPNSXUAY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|