C13H18N2 — CID 172930301
(E)-1-(3,5-diethylphenyl)-N-(methylideneamino)ethanimine (PubChem CID 172930301) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (E)-1-(3,5-diethylphenyl)-N-(methylideneamino)ethanimine.
| Compound Name | (E)-1-(3,5-diethylphenyl)-N-(methylideneamino)ethanimine |
|---|---|
| PubChem CID | 172930301 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (E)-1-(3,5-diethylphenyl)-N-(methylideneamino)ethanimine |
| SMILES | C=N/N=C(\C)c1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C13H18N2/c1-5-11-7-12(6-2)9-13(8-11)10(3)15-14-4/h7-9H,4-6H2,1-3H3/b15-10+ |
| InChIKey | QXHOQPXQMGWAKT-XNTDXEJSSA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|