C27H33ClFN8O+ — CID 172938404
N-[(E)-[5-[3-chloro-5-(2-ethyl-4-methylpyrrolidin-3-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-1-ium-4-ylpyrimidin-2-amine (PubChem CID 172938404) has the molecular formula C27H33ClFN8O+ and a molecular weight of 540.07 g/mol. Its IUPAC name is N-[(E)-[5-[3-chloro-5-(2-ethyl-4-methylpyrrolidin-3-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-1-ium-4-ylpyrimidin-2-amine.
| Compound Name | N-[(E)-[5-[3-chloro-5-(2-ethyl-4-methylpyrrolidin-3-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-1-ium-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 172938404 |
| Molecular Formula | C27H33ClFN8O+ |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[(E)-[5-[3-chloro-5-(2-ethyl-4-methylpyrrolidin-3-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-1-ium-4-ylpyrimidin-2-amine |
| SMILES | CCC1NCC(C)C1c1cc(Cl)cc(Nc2ccc(/C=N/Nc3ncc(F)c(N4CC[OH+]CC4)n3)nc2)c1 |
| InChI | InChI=1S/C27H32ClFN8O/c1-3-24-25(17(2)13-31-24)18-10-19(28)12-22(11-18)34-21-5-4-20(30-14-21)15-33-36-27-32-16-23(29)26(35-27)37-6-8-38-9-7-37/h4-5,10-12,14-17,24-25,31,34H,3,6-9,13H2,1-2H3,(H,32,35,36)/p+1/b33-15+ |
| InChIKey | JJKRZRSHXJHDFF-ROPCREHHSA-O |
| XLogP | 4.30 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|