C16H14Cl3F4N3O4 — CID 172941629
2,3-difluoroaniline;(2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide;2,2,2-trichloroethane-1,1-diol (PubChem CID 172941629) has the molecular formula C16H14Cl3F4N3O4 and a molecular weight of 494.66 g/mol. Its IUPAC name is 2,3-difluoroaniline;(2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide;2,2,2-trichloroethane-1,1-diol.
| Compound Name | 2,3-difluoroaniline;(2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 172941629 |
| Molecular Formula | C16H14Cl3F4N3O4 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 2,3-difluoroaniline;(2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide;2,2,2-trichloroethane-1,1-diol |
| SMILES | Nc1cccc(F)c1F.O=C(/C=N/O)Nc1cccc(F)c1F.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6F2N2O2.C6H5F2N.C2H3Cl3O2/c9-5-2-1-3-6(8(5)10)12-7(13)4-11-14;7-4-2-1-3-5(9)6(4)8;3-2(4,5)1(6)7/h1-4,14H,(H,12,13);1-3H,9H2;1,6-7H/b11-4+;; |
| InChIKey | RIIXPKXNOQOMLF-QKBHCULISA-N |
| XLogP | 3.58 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|